C22H37NO7 — CID 18646003
(2S)-2-[[1-[(4-ethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]methyl]-3-(2-methoxyethoxy)propanoic acid (PubChem CID 18646003) has the molecular formula C22H37NO7 and a molecular weight of 427.54 g/mol. Its IUPAC name is (2S)-2-[[1-[(4-ethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]methyl]-3-(2-methoxyethoxy)propanoic acid.
| Compound Name | (2S)-2-[[1-[(4-ethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]methyl]-3-(2-methoxyethoxy)propanoic acid |
|---|---|
| PubChem CID | 18646003 |
| Molecular Formula | C22H37NO7 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (2S)-2-[[1-[(4-ethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]methyl]-3-(2-methoxyethoxy)propanoic acid |
| SMILES | CCOC(=O)C1CCC(NC(=O)C2(C[C@@H](COCCOC)C(=O)O)CCCC2)CC1 |
| InChI | InChI=1S/C22H37NO7/c1-3-30-20(26)16-6-8-18(9-7-16)23-21(27)22(10-4-5-11-22)14-17(19(24)25)15-29-13-12-28-2/h16-18H,3-15H2,1-2H3,(H,23,27)(H,24,25)/t16?,17-,18?/m0/s1 |
| InChIKey | MQXCSAFYCZDKPC-ADKAHSJRSA-N |
| XLogP | 2.54 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|