C23H22Cl2N6OS — CID 18646488
1-[4-[[(2R,5R)-5-(2,4-dichlorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-2-yl]methylsulfanylmethyl]phenyl]-1,2,4-triazole (PubChem CID 18646488) has the molecular formula C23H22Cl2N6OS and a molecular weight of 501.44 g/mol. Its IUPAC name is 1-[4-[[(2R,5R)-5-(2,4-dichlorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-2-yl]methylsulfanylmethyl]phenyl]-1,2,4-triazole.
| Compound Name | 1-[4-[[(2R,5R)-5-(2,4-dichlorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-2-yl]methylsulfanylmethyl]phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 18646488 |
| Molecular Formula | C23H22Cl2N6OS |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 1-[4-[[(2R,5R)-5-(2,4-dichlorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-2-yl]methylsulfanylmethyl]phenyl]-1,2,4-triazole |
| SMILES | Clc1ccc([C@@]2(Cn3cncn3)CC[C@H](CSCc3ccc(-n4cncn4)cc3)O2)c(Cl)c1 |
| InChI | InChI=1S/C23H22Cl2N6OS/c24-18-3-6-21(22(25)9-18)23(12-30-15-26-13-28-30)8-7-20(32-23)11-33-10-17-1-4-19(5-2-17)31-16-27-14-29-31/h1-6,9,13-16,20H,7-8,10-12H2/t20-,23+/m1/s1 |
| InChIKey | DYVXCVNHUZVZTH-OFNKIYASSA-N |
| XLogP | 5.17 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |