C13H17FO7S — CID 18647290
(2R,3S,4S,5S)-2-fluoro-3,4,5,6-tetrahydroxy-6-(4-methylphenyl)sulfonylhexanal (PubChem CID 18647290) has the molecular formula C13H17FO7S and a molecular weight of 336.34 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-fluoro-3,4,5,6-tetrahydroxy-6-(4-methylphenyl)sulfonylhexanal.
| Compound Name | (2R,3S,4S,5S)-2-fluoro-3,4,5,6-tetrahydroxy-6-(4-methylphenyl)sulfonylhexanal |
|---|---|
| PubChem CID | 18647290 |
| Molecular Formula | C13H17FO7S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | (2R,3S,4S,5S)-2-fluoro-3,4,5,6-tetrahydroxy-6-(4-methylphenyl)sulfonylhexanal |
| SMILES | Cc1ccc(S(=O)(=O)C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](F)C=O)cc1 |
| InChI | InChI=1S/C13H17FO7S/c1-7-2-4-8(5-3-7)22(20,21)13(19)12(18)11(17)10(16)9(14)6-15/h2-6,9-13,16-19H,1H3/t9-,10+,11-,12-,13?/m0/s1 |
| InChIKey | OTSNVFNOJCJUJM-DQJFZVCTSA-N |
| XLogP | -1.29 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|