C26H29ClN4O5S — CID 18648528
ethyl N-[4-[[(2S,4R)-2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-N-methanethioylanilino]carbamate (PubChem CID 18648528) has the molecular formula C26H29ClN4O5S and a molecular weight of 545.06 g/mol. Its IUPAC name is ethyl N-[4-[[(2S,4R)-2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-N-methanethioylanilino]carbamate.
| Compound Name | ethyl N-[4-[[(2S,4R)-2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-N-methanethioylanilino]carbamate |
|---|---|
| PubChem CID | 18648528 |
| Molecular Formula | C26H29ClN4O5S |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | ethyl N-[4-[[(2S,4R)-2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-N-methanethioylanilino]carbamate |
| SMILES | CCOC(=O)NN(C=S)c1ccc(OC[C@@H]2CO[C@](CCc3ccc(Cl)cc3)(Cn3ccnc3)O2)cc1 |
| InChI | InChI=1S/C26H29ClN4O5S/c1-2-33-25(32)29-31(19-37)22-7-9-23(10-8-22)34-15-24-16-35-26(36-24,17-30-14-13-28-18-30)12-11-20-3-5-21(27)6-4-20/h3-10,13-14,18-19,24H,2,11-12,15-17H2,1H3,(H,29,32)/t24-,26+/m1/s1 |
| InChIKey | IEGPLMGJSYWXCY-RSXGOPAZSA-N |
| XLogP | 4.78 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|