C13H15IN2O4 — CID 18651556
1-[(1R,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-5-[(E)-2-iodoethenyl]pyrimidine-2,4-dione (PubChem CID 18651556) has the molecular formula C13H15IN2O4 and a molecular weight of 390.18 g/mol. Its IUPAC name is 1-[(1R,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-5-[(E)-2-iodoethenyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-5-[(E)-2-iodoethenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18651556 |
| Molecular Formula | C13H15IN2O4 |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 1-[(1R,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-5-[(E)-2-iodoethenyl]pyrimidine-2,4-dione |
| SMILES | C=C1[C@@H](CO)[C@H](O)C[C@H]1n1cc(/C=C/I)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H15IN2O4/c1-7-9(6-17)11(18)4-10(7)16-5-8(2-3-14)12(19)15-13(16)20/h2-3,5,9-11,17-18H,1,4,6H2,(H,15,19,20)/b3-2+/t9-,10-,11-/m1/s1 |
| InChIKey | PTNAJIJKJCOCJW-VYEHJAMSSA-N |
| XLogP | 0.41 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|