C18H16Cl2N2O3 — CID 18652954
(2S,4S)-4-(2-anilino-2-oxoethyl)-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylic acid (PubChem CID 18652954) has the molecular formula C18H16Cl2N2O3 and a molecular weight of 379.24 g/mol. Its IUPAC name is (2S,4S)-4-(2-anilino-2-oxoethyl)-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylic acid.
| Compound Name | (2S,4S)-4-(2-anilino-2-oxoethyl)-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 18652954 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | (2S,4S)-4-(2-anilino-2-oxoethyl)-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
| SMILES | O=C(C[C@@H]1C[C@@H](C(=O)O)Nc2cc(Cl)cc(Cl)c21)Nc1ccccc1 |
| InChI | InChI=1S/C18H16Cl2N2O3/c19-11-8-13(20)17-10(6-15(18(24)25)22-14(17)9-11)7-16(23)21-12-4-2-1-3-5-12/h1-5,8-10,15,22H,6-7H2,(H,21,23)(H,24,25)/t10-,15-/m0/s1 |
| InChIKey | OYIWRENTXLJIPF-BONVTDFDSA-N |
| XLogP | 4.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |