C21H29ClF2 — CID 18656459
5-[4-[(E)-4-chlorobut-3-enyl]cyclohexyl]-1,3-difluoro-2-pentylbenzene (PubChem CID 18656459) has the molecular formula C21H29ClF2 and a molecular weight of 354.91 g/mol. Its IUPAC name is 5-[4-[(E)-4-chlorobut-3-enyl]cyclohexyl]-1,3-difluoro-2-pentylbenzene.
| Compound Name | 5-[4-[(E)-4-chlorobut-3-enyl]cyclohexyl]-1,3-difluoro-2-pentylbenzene |
|---|---|
| PubChem CID | 18656459 |
| Molecular Formula | C21H29ClF2 |
| Molecular Weight | 354.91 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 5-[4-[(E)-4-chlorobut-3-enyl]cyclohexyl]-1,3-difluoro-2-pentylbenzene |
| SMILES | CCCCCc1c(F)cc(C2CCC(CC/C=C/Cl)CC2)cc1F |
| InChI | InChI=1S/C21H29ClF2/c1-2-3-4-8-19-20(23)14-18(15-21(19)24)17-11-9-16(10-12-17)7-5-6-13-22/h6,13-17H,2-5,7-12H2,1H3/b13-6+ |
| InChIKey | JFIHFYKEERRGQT-AWNIVKPZSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.91 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|