C19H20Cl2N2O — CID 18664719
[(3R)-3-(3,4-dichlorophenyl)piperazin-1-yl]-(3,5-dimethylphenyl)methanone (PubChem CID 18664719) has the molecular formula C19H20Cl2N2O and a molecular weight of 363.29 g/mol. Its IUPAC name is [(3R)-3-(3,4-dichlorophenyl)piperazin-1-yl]-(3,5-dimethylphenyl)methanone.
| Compound Name | [(3R)-3-(3,4-dichlorophenyl)piperazin-1-yl]-(3,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 18664719 |
| Molecular Formula | C19H20Cl2N2O |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [(3R)-3-(3,4-dichlorophenyl)piperazin-1-yl]-(3,5-dimethylphenyl)methanone |
| SMILES | Cc1cc(C)cc(C(=O)N2CCN[C@H](c3ccc(Cl)c(Cl)c3)C2)c1 |
| InChI | InChI=1S/C19H20Cl2N2O/c1-12-7-13(2)9-15(8-12)19(24)23-6-5-22-18(11-23)14-3-4-16(20)17(21)10-14/h3-4,7-10,18,22H,5-6,11H2,1-2H3/t18-/m0/s1 |
| InChIKey | BADGVUWNXHZMIU-SFHVURJKSA-N |
| XLogP | 4.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |