C26H42N2O3S — CID 18666605
N-[(2S)-3-cyclohexyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]-4-hydroxy-2-(2-methylpropyl)-5-sulfanylpentanamide (PubChem CID 18666605) has the molecular formula C26H42N2O3S and a molecular weight of 462.70 g/mol. Its IUPAC name is N-[(2S)-3-cyclohexyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]-4-hydroxy-2-(2-methylpropyl)-5-sulfanylpentanamide.
| Compound Name | N-[(2S)-3-cyclohexyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]-4-hydroxy-2-(2-methylpropyl)-5-sulfanylpentanamide |
|---|---|
| PubChem CID | 18666605 |
| Molecular Formula | C26H42N2O3S |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | N-[(2S)-3-cyclohexyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]-4-hydroxy-2-(2-methylpropyl)-5-sulfanylpentanamide |
| SMILES | CC(C)CC(CC(O)CS)C(=O)N[C@@H](CC1CCCCC1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C26H42N2O3S/c1-19(2)15-22(17-23(29)18-32)25(30)28-24(16-21-11-7-4-8-12-21)26(31)27-14-13-20-9-5-3-6-10-20/h3,5-6,9-10,19,21-24,29,32H,4,7-8,11-18H2,1-2H3,(H,27,31)(H,28,30)/t22?,23?,24-/m0/s1 |
| InChIKey | VLNWWKLOFKUGIU-VHYCJAOWSA-N |
| XLogP | 4.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|