C23H38NO4P — CID 70426452
2-[[[2-cyclohexyl-1-(2-phenylethylamino)ethyl]-hydroxyphosphoryl]methyl]-4-methylpentanoic acid (PubChem CID 70426452) has the molecular formula C23H38NO4P and a molecular weight of 423.53 g/mol. Its IUPAC name is 2-[[[2-cyclohexyl-1-(2-phenylethylamino)ethyl]-hydroxyphosphoryl]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[[2-cyclohexyl-1-(2-phenylethylamino)ethyl]-hydroxyphosphoryl]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 70426452 |
| Molecular Formula | C23H38NO4P |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 2-[[[2-cyclohexyl-1-(2-phenylethylamino)ethyl]-hydroxyphosphoryl]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CP(=O)(O)C(CC1CCCCC1)NCCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H38NO4P/c1-18(2)15-21(23(25)26)17-29(27,28)22(16-20-11-7-4-8-12-20)24-14-13-19-9-5-3-6-10-19/h3,5-6,9-10,18,20-22,24H,4,7-8,11-17H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | WLLINZHXZKVWFG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|