C25H40N2O2S — CID 18666607
N-[(2S)-3-cyclohexyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]-4-methyl-2-(2-sulfanylethyl)pentanamide (PubChem CID 18666607) has the molecular formula C25H40N2O2S and a molecular weight of 432.67 g/mol. Its IUPAC name is N-[(2S)-3-cyclohexyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]-4-methyl-2-(2-sulfanylethyl)pentanamide.
| Compound Name | N-[(2S)-3-cyclohexyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]-4-methyl-2-(2-sulfanylethyl)pentanamide |
|---|---|
| PubChem CID | 18666607 |
| Molecular Formula | C25H40N2O2S |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | N-[(2S)-3-cyclohexyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]-4-methyl-2-(2-sulfanylethyl)pentanamide |
| SMILES | CC(C)CC(CCS)C(=O)N[C@@H](CC1CCCCC1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C25H40N2O2S/c1-19(2)17-22(14-16-30)24(28)27-23(18-21-11-7-4-8-12-21)25(29)26-15-13-20-9-5-3-6-10-20/h3,5-6,9-10,19,21-23,30H,4,7-8,11-18H2,1-2H3,(H,26,29)(H,27,28)/t22?,23-/m0/s1 |
| InChIKey | GRRCQDZFWNKUGQ-WCSIJFPASA-N |
| XLogP | 4.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|