About 2-amino-1,2-dihydroimidazol-5-one
2-amino-1,2-dihydroimidazol-5-one (PubChem CID 18667660) has the molecular formula C3H5N3O
and a molecular weight of 99.09 g/mol. Its IUPAC name is 2-amino-1,2-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-amino-1,2-dihydroimidazol-5-one |
| PubChem CID | 18667660 |
| Molecular Formula | C3H5N3O |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.04 |
| IUPAC Name | 2-amino-1,2-dihydroimidazol-5-one |
| SMILES | NC1N=CC(=O)N1 |
| InChI | InChI=1S/C3H5N3O/c4-3-5-1-2(7)6-3/h1,3H,4H2,(H,6,7) |
| InChIKey | UQLHWVHOFXABHP-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1,2-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,2-dihydroimidazol-5-one?
The IUPAC name of 2-amino-1,2-dihydroimidazol-5-one (CID 18667660) is 2-amino-1,2-dihydroimidazol-5-one.
What is the SMILES notation for 2-amino-1,2-dihydroimidazol-5-one?
The canonical SMILES for 2-amino-1,2-dihydroimidazol-5-one is NC1N=CC(=O)N1.
What is the InChIKey of 2-amino-1,2-dihydroimidazol-5-one?
The InChIKey is UQLHWVHOFXABHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3O/c4-3-5-1-2(7)6-3/h1,3H,4H2,(H,6,7).
What are the key properties of 2-amino-1,2-dihydroimidazol-5-one?
2-amino-1,2-dihydroimidazol-5-one has a molecular weight of 99.09 g/mol, XLogP of -1.57, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,2-dihydroimidazol-5-one is sourced from PubChem (CID 18667660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).