C13H21N5O4 — CID 18678385
butyl N-(4-amino-1,3,5-triazin-2-yl)-N-butoxycarbonylcarbamate (PubChem CID 18678385) has the molecular formula C13H21N5O4 and a molecular weight of 311.34 g/mol. Its IUPAC name is butyl N-(4-amino-1,3,5-triazin-2-yl)-N-butoxycarbonylcarbamate.
| Compound Name | butyl N-(4-amino-1,3,5-triazin-2-yl)-N-butoxycarbonylcarbamate |
|---|---|
| PubChem CID | 18678385 |
| Molecular Formula | C13H21N5O4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | butyl N-(4-amino-1,3,5-triazin-2-yl)-N-butoxycarbonylcarbamate |
| SMILES | CCCCOC(=O)N(C(=O)OCCCC)c1ncnc(N)n1 |
| InChI | InChI=1S/C13H21N5O4/c1-3-5-7-21-12(19)18(13(20)22-8-6-4-2)11-16-9-15-10(14)17-11/h9H,3-8H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | QCGZSCWAXWBLDA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|