C10H18N4O — CID 21412792
5-butoxy-4-N,4-N-dimethylpyrimidine-2,4-diamine (PubChem CID 21412792) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 5-butoxy-4-N,4-N-dimethylpyrimidine-2,4-diamine.
| Compound Name | 5-butoxy-4-N,4-N-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 21412792 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 5-butoxy-4-N,4-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CCCCOc1cnc(N)nc1N(C)C |
| InChI | InChI=1S/C10H18N4O/c1-4-5-6-15-8-7-12-10(11)13-9(8)14(2)3/h7H,4-6H2,1-3H3,(H2,11,12,13) |
| InChIKey | WNOVSBWUCYYLBL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|