C11H15N3O — CID 18679321
1-(1-amino-2,3,4,5-tetrahydro-1,2-benzodiazepin-4-yl)ethanone (PubChem CID 18679321) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-(1-amino-2,3,4,5-tetrahydro-1,2-benzodiazepin-4-yl)ethanone.
| Compound Name | 1-(1-amino-2,3,4,5-tetrahydro-1,2-benzodiazepin-4-yl)ethanone |
|---|---|
| PubChem CID | 18679321 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 1-(1-amino-2,3,4,5-tetrahydro-1,2-benzodiazepin-4-yl)ethanone |
| SMILES | CC(=O)C1CNN(N)c2ccccc2C1 |
| InChI | InChI=1S/C11H15N3O/c1-8(15)10-6-9-4-2-3-5-11(9)14(12)13-7-10/h2-5,10,13H,6-7,12H2,1H3 |
| InChIKey | HTCBEHMFQCWYLZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|