C34H40O7 — CID 18682173
benzyl 2-benzyl-4-(2-methyl-3-phenylmethoxypropanoyl)oxy-3-(2-methylpropanoyloxy)pentanoate (PubChem CID 18682173) has the molecular formula C34H40O7 and a molecular weight of 560.69 g/mol. Its IUPAC name is benzyl 2-benzyl-4-(2-methyl-3-phenylmethoxypropanoyl)oxy-3-(2-methylpropanoyloxy)pentanoate.
| Compound Name | benzyl 2-benzyl-4-(2-methyl-3-phenylmethoxypropanoyl)oxy-3-(2-methylpropanoyloxy)pentanoate |
|---|---|
| PubChem CID | 18682173 |
| Molecular Formula | C34H40O7 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | benzyl 2-benzyl-4-(2-methyl-3-phenylmethoxypropanoyl)oxy-3-(2-methylpropanoyloxy)pentanoate |
| SMILES | CC(C)C(=O)OC(C(C)OC(=O)C(C)COCc1ccccc1)C(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H40O7/c1-24(2)32(35)41-31(26(4)40-33(36)25(3)21-38-22-28-16-10-6-11-17-28)30(20-27-14-8-5-9-15-27)34(37)39-23-29-18-12-7-13-19-29/h5-19,24-26,30-31H,20-23H2,1-4H3 |
| InChIKey | YBKBNYYSLAHWCA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|