C27H35AcNO7 — CID 18681775
actinium;benzyl 4-(2-amino-3-hydroxybutanoyl)oxy-2-benzyl-3-(2-methylpropanoyloxy)pentanoate (PubChem CID 18681775) has the molecular formula C27H35AcNO7 and a molecular weight of 712.58 g/mol. Its IUPAC name is actinium;benzyl 4-(2-amino-3-hydroxybutanoyl)oxy-2-benzyl-3-(2-methylpropanoyloxy)pentanoate.
| Compound Name | actinium;benzyl 4-(2-amino-3-hydroxybutanoyl)oxy-2-benzyl-3-(2-methylpropanoyloxy)pentanoate |
|---|---|
| PubChem CID | 18681775 |
| Molecular Formula | C27H35AcNO7 |
| Molecular Weight | 712.58 g/mol |
| Exact Mass | 712.27 |
| IUPAC Name | actinium;benzyl 4-(2-amino-3-hydroxybutanoyl)oxy-2-benzyl-3-(2-methylpropanoyloxy)pentanoate |
| SMILES | CC(C)C(=O)OC(C(C)OC(=O)C(N)C(C)O)C(Cc1ccccc1)C(=O)OCc1ccccc1.[Ac] |
| InChI | InChI=1S/C27H35NO7.Ac/c1-17(2)25(30)35-24(19(4)34-27(32)23(28)18(3)29)22(15-20-11-7-5-8-12-20)26(31)33-16-21-13-9-6-10-14-21;/h5-14,17-19,22-24,29H,15-16,28H2,1-4H3; |
| InChIKey | GXNWQKUDGPPOKE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.58 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|