C22H44O3Si — CID 18683182
(E)-7-ethenyl-5-[2-[7-methoxyheptyl(dimethyl)silyl]ethyl]oct-2-ene-1,8-diol (PubChem CID 18683182) has the molecular formula C22H44O3Si and a molecular weight of 384.68 g/mol. Its IUPAC name is (E)-7-ethenyl-5-[2-[7-methoxyheptyl(dimethyl)silyl]ethyl]oct-2-ene-1,8-diol.
| Compound Name | (E)-7-ethenyl-5-[2-[7-methoxyheptyl(dimethyl)silyl]ethyl]oct-2-ene-1,8-diol |
|---|---|
| PubChem CID | 18683182 |
| Molecular Formula | C22H44O3Si |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | (E)-7-ethenyl-5-[2-[7-methoxyheptyl(dimethyl)silyl]ethyl]oct-2-ene-1,8-diol |
| SMILES | C=CC(CO)CC(C/C=C/CO)CC[Si](C)(C)CCCCCCCOC |
| InChI | InChI=1S/C22H44O3Si/c1-5-21(20-24)19-22(13-9-10-15-23)14-18-26(3,4)17-12-8-6-7-11-16-25-2/h5,9-10,21-24H,1,6-8,11-20H2,2-4H3/b10-9+ |
| InChIKey | XHUIUIHXKMEKTA-MDZDMXLPSA-N |
| XLogP | 5.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|