C6H5N3O3 — CID 18683711
1,2,3-triisocyanatopropane (PubChem CID 18683711) has the molecular formula C6H5N3O3 and a molecular weight of 167.12 g/mol. Its IUPAC name is 1,2,3-triisocyanatopropane.
| Compound Name | 1,2,3-triisocyanatopropane |
|---|---|
| PubChem CID | 18683711 |
| Molecular Formula | C6H5N3O3 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 1,2,3-triisocyanatopropane |
| SMILES | O=C=NCC(CN=C=O)N=C=O |
| InChI | InChI=1S/C6H5N3O3/c10-3-7-1-6(9-5-12)2-8-4-11/h6H,1-2H2 |
| InChIKey | IUBBUFFEDKCLTI-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|