About [4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol
[4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol (PubChem CID 18683751) has the molecular formula C13H13ClO4S
and a molecular weight of 300.76 g/mol. Its IUPAC name is [4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol.
Molecular Properties
| Compound Name | [4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol |
| PubChem CID | 18683751 |
| Molecular Formula | C13H13ClO4S |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | [4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol |
| SMILES | OC(c1ccc(-c2ccc(Cl)cc2)cc1)S(O)(O)O |
| InChI | InChI=1S/C13H13ClO4S/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)19(16,17)18/h1-8,13,15-18H |
| InChIKey | WCHWGJWMSGVXGQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol?
The IUPAC name of [4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol (CID 18683751) is [4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol.
What is the SMILES notation for [4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol?
The canonical SMILES for [4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol is OC(c1ccc(-c2ccc(Cl)cc2)cc1)S(O)(O)O.
What is the InChIKey of [4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol?
The InChIKey is WCHWGJWMSGVXGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClO4S/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)19(16,17)18/h1-8,13,15-18H.
What are the key properties of [4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol?
[4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol has a molecular weight of 300.76 g/mol, XLogP of 4.22, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-chlorophenyl)phenyl]-(trihydroxy-λ4-sulfanyl)methanol is sourced from PubChem (CID 18683751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).