C23H13F6N3O3 — CID 18685765
(1E)-N-[6-benzoyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-a]pyridin-2-yl]-1-(difluoromethoxy)methanimidoyl fluoride (PubChem CID 18685765) has the molecular formula C23H13F6N3O3 and a molecular weight of 493.36 g/mol. Its IUPAC name is (1E)-N-[6-benzoyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-a]pyridin-2-yl]-1-(difluoromethoxy)methanimidoyl fluoride.
| Compound Name | (1E)-N-[6-benzoyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-a]pyridin-2-yl]-1-(difluoromethoxy)methanimidoyl fluoride |
|---|---|
| PubChem CID | 18685765 |
| Molecular Formula | C23H13F6N3O3 |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | (1E)-N-[6-benzoyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-a]pyridin-2-yl]-1-(difluoromethoxy)methanimidoyl fluoride |
| SMILES | O=C(c1ccccc1)c1ccc2nc(/N=C(/F)OC(F)F)c(-c3cccc(OC(F)(F)F)c3)n2c1 |
| InChI | InChI=1S/C23H13F6N3O3/c24-21(25)34-22(26)31-20-18(14-7-4-8-16(11-14)35-23(27,28)29)32-12-15(9-10-17(32)30-20)19(33)13-5-2-1-3-6-13/h1-12,21H/b31-22- |
| InChIKey | JIXUDHOENWSCIC-VAMRJTSQSA-N |
| XLogP | 6.33 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|