C26H16F3N3O2 — CID 18685759
(1E)-N-(6-benzoyl-3-naphthalen-2-ylimidazo[1,2-a]pyridin-2-yl)-1-(difluoromethoxy)methanimidoyl fluoride (PubChem CID 18685759) has the molecular formula C26H16F3N3O2 and a molecular weight of 459.43 g/mol. Its IUPAC name is (1E)-N-(6-benzoyl-3-naphthalen-2-ylimidazo[1,2-a]pyridin-2-yl)-1-(difluoromethoxy)methanimidoyl fluoride.
| Compound Name | (1E)-N-(6-benzoyl-3-naphthalen-2-ylimidazo[1,2-a]pyridin-2-yl)-1-(difluoromethoxy)methanimidoyl fluoride |
|---|---|
| PubChem CID | 18685759 |
| Molecular Formula | C26H16F3N3O2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (1E)-N-(6-benzoyl-3-naphthalen-2-ylimidazo[1,2-a]pyridin-2-yl)-1-(difluoromethoxy)methanimidoyl fluoride |
| SMILES | O=C(c1ccccc1)c1ccc2nc(/N=C(/F)OC(F)F)c(-c3ccc4ccccc4c3)n2c1 |
| InChI | InChI=1S/C26H16F3N3O2/c27-25(28)34-26(29)31-24-22(19-11-10-16-6-4-5-9-18(16)14-19)32-15-20(12-13-21(32)30-24)23(33)17-7-2-1-3-8-17/h1-15,25H/b31-26- |
| InChIKey | BBVDEZZRGAECJZ-ZXPTYKNPSA-N |
| XLogP | 6.58 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|