C22H13F3N4O4 — CID 18685771
(1E)-N-[6-benzoyl-3-(4-nitrophenyl)imidazo[1,2-a]pyridin-2-yl]-1-(difluoromethoxy)methanimidoyl fluoride (PubChem CID 18685771) has the molecular formula C22H13F3N4O4 and a molecular weight of 454.36 g/mol. Its IUPAC name is (1E)-N-[6-benzoyl-3-(4-nitrophenyl)imidazo[1,2-a]pyridin-2-yl]-1-(difluoromethoxy)methanimidoyl fluoride.
| Compound Name | (1E)-N-[6-benzoyl-3-(4-nitrophenyl)imidazo[1,2-a]pyridin-2-yl]-1-(difluoromethoxy)methanimidoyl fluoride |
|---|---|
| PubChem CID | 18685771 |
| Molecular Formula | C22H13F3N4O4 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (1E)-N-[6-benzoyl-3-(4-nitrophenyl)imidazo[1,2-a]pyridin-2-yl]-1-(difluoromethoxy)methanimidoyl fluoride |
| SMILES | O=C(c1ccccc1)c1ccc2nc(/N=C(/F)OC(F)F)c(-c3ccc([N+](=O)[O-])cc3)n2c1 |
| InChI | InChI=1S/C22H13F3N4O4/c23-21(24)33-22(25)27-20-18(13-6-9-16(10-7-13)29(31)32)28-12-15(8-11-17(28)26-20)19(30)14-4-2-1-3-5-14/h1-12,21H/b27-22- |
| InChIKey | GVOAWMMGKXYXHG-QYQHSDTDSA-N |
| XLogP | 5.34 |
| TPSA | 99.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|