C23H13F6N3O2 — CID 73456563
N-[6-benzoyl-3-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-2-yl]-1-(difluoromethoxy)methanimidoyl fluoride (PubChem CID 73456563) has the molecular formula C23H13F6N3O2 and a molecular weight of 477.36 g/mol. Its IUPAC name is N-[6-benzoyl-3-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-2-yl]-1-(difluoromethoxy)methanimidoyl fluoride.
| Compound Name | N-[6-benzoyl-3-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-2-yl]-1-(difluoromethoxy)methanimidoyl fluoride |
|---|---|
| PubChem CID | 73456563 |
| Molecular Formula | C23H13F6N3O2 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | N-[6-benzoyl-3-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-2-yl]-1-(difluoromethoxy)methanimidoyl fluoride |
| SMILES | O=C(c1ccccc1)c1ccc2nc(N=C(F)OC(F)F)c(-c3ccc(C(F)(F)F)cc3)n2c1 |
| InChI | InChI=1S/C23H13F6N3O2/c24-21(25)34-22(26)31-20-18(13-6-9-16(10-7-13)23(27,28)29)32-12-15(8-11-17(32)30-20)19(33)14-4-2-1-3-5-14/h1-12,21H |
| InChIKey | GHRFRQMENXJMHL-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|