C23H26F2N2O2 — CID 18687663
1-[4-(5-fluoro-1H-indol-3-yl)cyclohexyl]-2-(4-fluoro-2-methoxyphenoxy)ethanamine (PubChem CID 18687663) has the molecular formula C23H26F2N2O2 and a molecular weight of 400.47 g/mol. Its IUPAC name is 1-[4-(5-fluoro-1H-indol-3-yl)cyclohexyl]-2-(4-fluoro-2-methoxyphenoxy)ethanamine.
| Compound Name | 1-[4-(5-fluoro-1H-indol-3-yl)cyclohexyl]-2-(4-fluoro-2-methoxyphenoxy)ethanamine |
|---|---|
| PubChem CID | 18687663 |
| Molecular Formula | C23H26F2N2O2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1-[4-(5-fluoro-1H-indol-3-yl)cyclohexyl]-2-(4-fluoro-2-methoxyphenoxy)ethanamine |
| SMILES | COc1cc(F)ccc1OCC(N)C1CCC(c2c[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C23H26F2N2O2/c1-28-23-11-17(25)7-9-22(23)29-13-20(26)15-4-2-14(3-5-15)19-12-27-21-8-6-16(24)10-18(19)21/h6-12,14-15,20,27H,2-5,13,26H2,1H3 |
| InChIKey | GHDRDBMEEFCRLX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |