About 3-ethoxyphenoxathiine
3-ethoxyphenoxathiine (PubChem CID 18687728) has the molecular formula C14H12O2S
and a molecular weight of 244.31 g/mol. Its IUPAC name is 3-ethoxyphenoxathiine.
Molecular Properties
| Compound Name | 3-ethoxyphenoxathiine |
| PubChem CID | 18687728 |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 3-ethoxyphenoxathiine |
| SMILES | CCOc1ccc2c(c1)Oc1ccccc1S2 |
| InChI | InChI=1S/C14H12O2S/c1-2-15-10-7-8-14-12(9-10)16-11-5-3-4-6-13(11)17-14/h3-9H,2H2,1H3 |
| InChIKey | FCDUJMMNKCACBR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethoxyphenoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxyphenoxathiine?
The IUPAC name of 3-ethoxyphenoxathiine (CID 18687728) is 3-ethoxyphenoxathiine.
What is the SMILES notation for 3-ethoxyphenoxathiine?
The canonical SMILES for 3-ethoxyphenoxathiine is CCOc1ccc2c(c1)Oc1ccccc1S2.
What is the InChIKey of 3-ethoxyphenoxathiine?
The InChIKey is FCDUJMMNKCACBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2S/c1-2-15-10-7-8-14-12(9-10)16-11-5-3-4-6-13(11)17-14/h3-9H,2H2,1H3.
What are the key properties of 3-ethoxyphenoxathiine?
3-ethoxyphenoxathiine has a molecular weight of 244.31 g/mol, XLogP of 4.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxyphenoxathiine is sourced from PubChem (CID 18687728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).