C15H26O — CID 18689146
1-[(2E,4E)-hexa-2,4-dienoxy]-4-propylcyclohexane (PubChem CID 18689146) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 1-[(2E,4E)-hexa-2,4-dienoxy]-4-propylcyclohexane.
| Compound Name | 1-[(2E,4E)-hexa-2,4-dienoxy]-4-propylcyclohexane |
|---|---|
| PubChem CID | 18689146 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 1-[(2E,4E)-hexa-2,4-dienoxy]-4-propylcyclohexane |
| SMILES | C/C=C/C=C/COC1CCC(CCC)CC1 |
| InChI | InChI=1S/C15H26O/c1-3-5-6-7-13-16-15-11-9-14(8-4-2)10-12-15/h3,5-7,14-15H,4,8-13H2,1-2H3/b5-3+,7-6+ |
| InChIKey | ZKMGXIXUSSHWJP-TWTPFVCWSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|