About lithium 4-methyldecoxybenzene
lithium 4-methyldecoxybenzene (PubChem CID 14069914) has the molecular formula C17H27LiO
and a molecular weight of 254.34 g/mol. Its IUPAC name is lithium 4-methyldecoxybenzene.
Molecular Properties
| Compound Name | lithium 4-methyldecoxybenzene |
| PubChem CID | 14069914 |
| Molecular Formula | C17H27LiO |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | lithium 4-methyldecoxybenzene |
| SMILES | CCCCCCC(C)CCCOc1cc[c-]cc1.[Li+] |
| InChI | InChI=1S/C17H27O.Li/c1-3-4-5-7-11-16(2)12-10-15-18-17-13-8-6-9-14-17;/h8-9,13-14,16H,3-5,7,10-12,15H2,1-2H3;/q-1;+1 |
| InChIKey | POXGZHDUSKKBOR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 4-methyldecoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 4-methyldecoxybenzene?
The IUPAC name of lithium 4-methyldecoxybenzene (CID 14069914) is lithium 4-methyldecoxybenzene.
What is the SMILES notation for lithium 4-methyldecoxybenzene?
The canonical SMILES for lithium 4-methyldecoxybenzene is CCCCCCC(C)CCCOc1cc[c-]cc1.[Li+].
What is the InChIKey of lithium 4-methyldecoxybenzene?
The InChIKey is POXGZHDUSKKBOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27O.Li/c1-3-4-5-7-11-16(2)12-10-15-18-17-13-8-6-9-14-17;/h8-9,13-14,16H,3-5,7,10-12,15H2,1-2H3;/q-1;+1.
What are the key properties of lithium 4-methyldecoxybenzene?
lithium 4-methyldecoxybenzene has a molecular weight of 254.34 g/mol, XLogP of 2.26, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 4-methyldecoxybenzene is sourced from PubChem (CID 14069914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).