C15H26O — CID 118370479
3-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxymethyl]heptane (PubChem CID 118370479) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 3-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxymethyl]heptane.
| Compound Name | 3-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxymethyl]heptane |
|---|---|
| PubChem CID | 118370479 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 3-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxymethyl]heptane |
| SMILES | C=C/C(=C\C=C/C)OCC(CC)CCCC |
| InChI | InChI=1S/C15H26O/c1-5-9-11-14(7-3)13-16-15(8-4)12-10-6-2/h6,8,10,12,14H,4-5,7,9,11,13H2,1-3H3/b10-6-,15-12+ |
| InChIKey | IMXKHLRGFXIZQF-MVSUFEPBSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|