C14H22O — CID 123350690
1-ethyl-4-hexa-1,3,5-trien-3-yloxycyclohexane (PubChem CID 123350690) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-ethyl-4-hexa-1,3,5-trien-3-yloxycyclohexane.
| Compound Name | 1-ethyl-4-hexa-1,3,5-trien-3-yloxycyclohexane |
|---|---|
| PubChem CID | 123350690 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 1-ethyl-4-hexa-1,3,5-trien-3-yloxycyclohexane |
| SMILES | C=CC=C(C=C)OC1CCC(CC)CC1 |
| InChI | InChI=1S/C14H22O/c1-4-7-13(6-3)15-14-10-8-12(5-2)9-11-14/h4,6-7,12,14H,1,3,5,8-11H2,2H3 |
| InChIKey | NHAQIIAWSRKWRT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|