C19H34O — CID 54051203
1-heptyl-4-hexa-2,4-dienoxycyclohexane (PubChem CID 54051203) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is 1-heptyl-4-hexa-2,4-dienoxycyclohexane.
| Compound Name | 1-heptyl-4-hexa-2,4-dienoxycyclohexane |
|---|---|
| PubChem CID | 54051203 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | 1-heptyl-4-hexa-2,4-dienoxycyclohexane |
| SMILES | CC=CC=CCOC1CCC(CCCCCCC)CC1 |
| InChI | InChI=1S/C19H34O/c1-3-5-7-9-10-12-18-13-15-19(16-14-18)20-17-11-8-6-4-2/h4,6,8,11,18-19H,3,5,7,9-10,12-17H2,1-2H3 |
| InChIKey | LSZIQLAGLBLBCS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|