C22H17N3O3 — CID 18694744
6,7-dimethyl-5-nitroso-2,3-diphenoxyquinoxaline (PubChem CID 18694744) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is 6,7-dimethyl-5-nitroso-2,3-diphenoxyquinoxaline.
| Compound Name | 6,7-dimethyl-5-nitroso-2,3-diphenoxyquinoxaline |
|---|---|
| PubChem CID | 18694744 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 6,7-dimethyl-5-nitroso-2,3-diphenoxyquinoxaline |
| SMILES | Cc1cc2nc(Oc3ccccc3)c(Oc3ccccc3)nc2c(N=O)c1C |
| InChI | InChI=1S/C22H17N3O3/c1-14-13-18-20(19(25-26)15(14)2)24-22(28-17-11-7-4-8-12-17)21(23-18)27-16-9-5-3-6-10-16/h3-13H,1-2H3 |
| InChIKey | MLPABVOURNVYML-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 73.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |