C28H38N4O3 — CID 18695978
benzyl N-[4-[4-(3-ethyl-2-oxobenzimidazol-1-yl)piperidin-1-yl]-4-methylpentyl]carbamate (PubChem CID 18695978) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is benzyl N-[4-[4-(3-ethyl-2-oxobenzimidazol-1-yl)piperidin-1-yl]-4-methylpentyl]carbamate.
| Compound Name | benzyl N-[4-[4-(3-ethyl-2-oxobenzimidazol-1-yl)piperidin-1-yl]-4-methylpentyl]carbamate |
|---|---|
| PubChem CID | 18695978 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | benzyl N-[4-[4-(3-ethyl-2-oxobenzimidazol-1-yl)piperidin-1-yl]-4-methylpentyl]carbamate |
| SMILES | CCn1c(=O)n(C2CCN(C(C)(C)CCCNC(=O)OCc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C28H38N4O3/c1-4-31-24-13-8-9-14-25(24)32(27(31)34)23-15-19-30(20-16-23)28(2,3)17-10-18-29-26(33)35-21-22-11-6-5-7-12-22/h5-9,11-14,23H,4,10,15-21H2,1-3H3,(H,29,33) |
| InChIKey | URNCIGZXZIAJPY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|