C13H6Cl5N3 — CID 18699447
4-(2,2-dichlorocyclopropyl)-1-(2,4,6-trichlorophenyl)pyrazole-3-carbonitrile (PubChem CID 18699447) has the molecular formula C13H6Cl5N3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-(2,2-dichlorocyclopropyl)-1-(2,4,6-trichlorophenyl)pyrazole-3-carbonitrile.
| Compound Name | 4-(2,2-dichlorocyclopropyl)-1-(2,4,6-trichlorophenyl)pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 18699447 |
| Molecular Formula | C13H6Cl5N3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 378.90 |
| IUPAC Name | 4-(2,2-dichlorocyclopropyl)-1-(2,4,6-trichlorophenyl)pyrazole-3-carbonitrile |
| SMILES | N#Cc1nn(-c2c(Cl)cc(Cl)cc2Cl)cc1C1CC1(Cl)Cl |
| InChI | InChI=1S/C13H6Cl5N3/c14-6-1-9(15)12(10(16)2-6)21-5-7(11(4-19)20-21)8-3-13(8,17)18/h1-2,5,8H,3H2 |
| InChIKey | BOFKSDMJCKNEED-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|