C22H17FN2O3S — CID 18701478
4-[2-benzyl-5-(2-fluorophenyl)-1,3-oxazol-4-yl]benzenesulfonamide (PubChem CID 18701478) has the molecular formula C22H17FN2O3S and a molecular weight of 408.45 g/mol. Its IUPAC name is 4-[2-benzyl-5-(2-fluorophenyl)-1,3-oxazol-4-yl]benzenesulfonamide.
| Compound Name | 4-[2-benzyl-5-(2-fluorophenyl)-1,3-oxazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 18701478 |
| Molecular Formula | C22H17FN2O3S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 4-[2-benzyl-5-(2-fluorophenyl)-1,3-oxazol-4-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2nc(Cc3ccccc3)oc2-c2ccccc2F)cc1 |
| InChI | InChI=1S/C22H17FN2O3S/c23-19-9-5-4-8-18(19)22-21(16-10-12-17(13-11-16)29(24,26)27)25-20(28-22)14-15-6-2-1-3-7-15/h1-13H,14H2,(H2,24,26,27) |
| InChIKey | OOCLBIAGZWCREL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |