C23H23BrN2O4 — CID 18705056
5-(1,3-benzodioxol-5-ylmethyl)-1-(4-bromophenyl)-2,3,3-trimethyl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 18705056) has the molecular formula C23H23BrN2O4 and a molecular weight of 471.35 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyl)-1-(4-bromophenyl)-2,3,3-trimethyl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyl)-1-(4-bromophenyl)-2,3,3-trimethyl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 18705056 |
| Molecular Formula | C23H23BrN2O4 |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyl)-1-(4-bromophenyl)-2,3,3-trimethyl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | CN1C(c2ccc(Br)cc2)C2C(=O)N(Cc3ccc4c(c3)OCO4)C(=O)C2C1(C)C |
| InChI | InChI=1S/C23H23BrN2O4/c1-23(2)19-18(20(25(23)3)14-5-7-15(24)8-6-14)21(27)26(22(19)28)11-13-4-9-16-17(10-13)30-12-29-16/h4-10,18-20H,11-12H2,1-3H3 |
| InChIKey | UOIOXLZZIBJTJE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|