C6H3N5O2S — CID 18707701
5-(3-nitro-1H-pyrrol-2-yl)-1,2,4-triazole-3-thione (PubChem CID 18707701) has the molecular formula C6H3N5O2S and a molecular weight of 209.19 g/mol. Its IUPAC name is 5-(3-nitro-1H-pyrrol-2-yl)-1,2,4-triazole-3-thione.
| Compound Name | 5-(3-nitro-1H-pyrrol-2-yl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 18707701 |
| Molecular Formula | C6H3N5O2S |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | 5-(3-nitro-1H-pyrrol-2-yl)-1,2,4-triazole-3-thione |
| SMILES | O=[N+]([O-])c1cc[nH]c1C1=NC(=S)N=N1 |
| InChI | InChI=1S/C6H3N5O2S/c12-11(13)3-1-2-7-4(3)5-8-6(14)10-9-5/h1-2,7H |
| InChIKey | KSXOKMWAMGAVMS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|