C11H10ClN5S2 — CID 18708678
4-chloro-2-(2-propyltetrazol-5-yl)sulfanyl-1,3-benzothiazole (PubChem CID 18708678) has the molecular formula C11H10ClN5S2 and a molecular weight of 311.82 g/mol. Its IUPAC name is 4-chloro-2-(2-propyltetrazol-5-yl)sulfanyl-1,3-benzothiazole.
| Compound Name | 4-chloro-2-(2-propyltetrazol-5-yl)sulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 18708678 |
| Molecular Formula | C11H10ClN5S2 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 4-chloro-2-(2-propyltetrazol-5-yl)sulfanyl-1,3-benzothiazole |
| SMILES | CCCn1nnc(Sc2nc3c(Cl)cccc3s2)n1 |
| InChI | InChI=1S/C11H10ClN5S2/c1-2-6-17-15-10(14-16-17)19-11-13-9-7(12)4-3-5-8(9)18-11/h3-5H,2,6H2,1H3 |
| InChIKey | DJYILVIIEDGACB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |