About 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide
4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide (PubChem CID 18709399) has the molecular formula C14H9ClN6O2S3
and a molecular weight of 424.92 g/mol. Its IUPAC name is 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide |
| PubChem CID | 18709399 |
| Molecular Formula | C14H9ClN6O2S3 |
| Molecular Weight | 424.92 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2nnnc2Sc2nc3c(Cl)cccc3s2)cc1 |
| InChI | InChI=1S/C14H9ClN6O2S3/c15-10-2-1-3-11-12(10)17-14(24-11)25-13-18-19-20-21(13)8-4-6-9(7-5-8)26(16,22)23/h1-7H,(H2,16,22,23) |
| InChIKey | JTEHTECORATDKH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.92 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide?
The IUPAC name of 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide (CID 18709399) is 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide.
What is the SMILES notation for 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide?
The canonical SMILES for 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide is NS(=O)(=O)c1ccc(-n2nnnc2Sc2nc3c(Cl)cccc3s2)cc1.
What is the InChIKey of 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide?
The InChIKey is JTEHTECORATDKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClN6O2S3/c15-10-2-1-3-11-12(10)17-14(24-11)25-13-18-19-20-21(13)8-4-6-9(7-5-8)26(16,22)23/h1-7H,(H2,16,22,23).
What are the key properties of 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide?
4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide has a molecular weight of 424.92 g/mol, XLogP of 2.72, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-1-yl]benzenesulfonamide is sourced from PubChem (CID 18709399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).