C26H37N5O4S — CID 18711113
2-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-[2-[4-[(2,4,5-trimethylphenyl)sulfonylamino]phenyl]hydrazinyl]acetamide (PubChem CID 18711113) has the molecular formula C26H37N5O4S and a molecular weight of 515.68 g/mol. Its IUPAC name is 2-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-[2-[4-[(2,4,5-trimethylphenyl)sulfonylamino]phenyl]hydrazinyl]acetamide.
| Compound Name | 2-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-[2-[4-[(2,4,5-trimethylphenyl)sulfonylamino]phenyl]hydrazinyl]acetamide |
|---|---|
| PubChem CID | 18711113 |
| Molecular Formula | C26H37N5O4S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 2-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-[2-[4-[(2,4,5-trimethylphenyl)sulfonylamino]phenyl]hydrazinyl]acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccc(NNC(=O)C(=O)NC3CC(C)(C)NC(C)(C)C3)cc2)cc1C |
| InChI | InChI=1S/C26H37N5O4S/c1-16-12-18(3)22(13-17(16)2)36(34,35)30-20-10-8-19(9-11-20)28-29-24(33)23(32)27-21-14-25(4,5)31-26(6,7)15-21/h8-13,21,28,30-31H,14-15H2,1-7H3,(H,27,32)(H,29,33) |
| InChIKey | GNNUCOKDXAVINM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 128.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|