C31H51N5O8S2 — CID 22898252
2-[2-[4-[2-[[(8E)-7-heptyl-5,7-dihydro-4H-1,2,3,6-tetraoxonin-8-yl]sulfanyl]ethylsulfonylamino]phenyl]hydrazinyl]-2-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide (PubChem CID 22898252) has the molecular formula C31H51N5O8S2 and a molecular weight of 685.91 g/mol. Its IUPAC name is 2-[2-[4-[2-[[(8E)-7-heptyl-5,7-dihydro-4H-1,2,3,6-tetraoxonin-8-yl]sulfanyl]ethylsulfonylamino]phenyl]hydrazinyl]-2-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide.
| Compound Name | 2-[2-[4-[2-[[(8E)-7-heptyl-5,7-dihydro-4H-1,2,3,6-tetraoxonin-8-yl]sulfanyl]ethylsulfonylamino]phenyl]hydrazinyl]-2-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 22898252 |
| Molecular Formula | C31H51N5O8S2 |
| Molecular Weight | 685.91 g/mol |
| Exact Mass | 685.32 |
| IUPAC Name | 2-[2-[4-[2-[[(8E)-7-heptyl-5,7-dihydro-4H-1,2,3,6-tetraoxonin-8-yl]sulfanyl]ethylsulfonylamino]phenyl]hydrazinyl]-2-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
| SMILES | CCCCCCCC1OCCOOO/C=C\1SCCS(=O)(=O)Nc1ccc(NNC(=O)C(=O)NC2CC(C)(C)NC(C)(C)C2)cc1 |
| InChI | InChI=1S/C31H51N5O8S2/c1-6-7-8-9-10-11-26-27(22-43-44-42-17-16-41-26)45-18-19-46(39,40)35-24-14-12-23(13-15-24)33-34-29(38)28(37)32-25-20-30(2,3)36-31(4,5)21-25/h12-15,22,25-26,33,35-36H,6-11,16-21H2,1-5H3,(H,32,37)(H,34,38)/b27-22+ |
| InChIKey | QBBKKGZEQHIKNE-HPNDGRJYSA-N |
| XLogP | 4.51 |
| TPSA | 165.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.91 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|