C26H29NO3 — CID 18716877
N-(3-tert-butyl-2-hydroxy-5-methylphenyl)-2-hydroxy-5-methyl-4-(4-methylphenyl)benzamide (PubChem CID 18716877) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is N-(3-tert-butyl-2-hydroxy-5-methylphenyl)-2-hydroxy-5-methyl-4-(4-methylphenyl)benzamide.
| Compound Name | N-(3-tert-butyl-2-hydroxy-5-methylphenyl)-2-hydroxy-5-methyl-4-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 18716877 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N-(3-tert-butyl-2-hydroxy-5-methylphenyl)-2-hydroxy-5-methyl-4-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(-c2cc(O)c(C(=O)Nc3cc(C)cc(C(C)(C)C)c3O)cc2C)cc1 |
| InChI | InChI=1S/C26H29NO3/c1-15-7-9-18(10-8-15)19-14-23(28)20(13-17(19)3)25(30)27-22-12-16(2)11-21(24(22)29)26(4,5)6/h7-14,28-29H,1-6H3,(H,27,30) |
| InChIKey | BJBPZESEMPAZIA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|