C26H30N2O4S — CID 18716979
N-(3-tert-butyl-2-hydroxy-5-methylphenyl)-2-(methanesulfonamido)-5-(3-methylphenyl)benzamide (PubChem CID 18716979) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is N-(3-tert-butyl-2-hydroxy-5-methylphenyl)-2-(methanesulfonamido)-5-(3-methylphenyl)benzamide.
| Compound Name | N-(3-tert-butyl-2-hydroxy-5-methylphenyl)-2-(methanesulfonamido)-5-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 18716979 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-(3-tert-butyl-2-hydroxy-5-methylphenyl)-2-(methanesulfonamido)-5-(3-methylphenyl)benzamide |
| SMILES | Cc1cccc(-c2ccc(NS(C)(=O)=O)c(C(=O)Nc3cc(C)cc(C(C)(C)C)c3O)c2)c1 |
| InChI | InChI=1S/C26H30N2O4S/c1-16-8-7-9-18(12-16)19-10-11-22(28-33(6,31)32)20(15-19)25(30)27-23-14-17(2)13-21(24(23)29)26(3,4)5/h7-15,28-29H,1-6H3,(H,27,30) |
| InChIKey | IVTSXDPFLUCOCU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|