C33H41N3O9S — CID 91195022
N-(3-tert-butyl-5-formyl-2-hydroxyphenyl)-3-(methanesulfonamido)benzamide;ethyl N-(3-tert-butyl-5-formyl-2-hydroxyphenyl)carbamate (PubChem CID 91195022) has the molecular formula C33H41N3O9S and a molecular weight of 655.77 g/mol. Its IUPAC name is N-(3-tert-butyl-5-formyl-2-hydroxyphenyl)-3-(methanesulfonamido)benzamide;ethyl N-(3-tert-butyl-5-formyl-2-hydroxyphenyl)carbamate.
| Compound Name | N-(3-tert-butyl-5-formyl-2-hydroxyphenyl)-3-(methanesulfonamido)benzamide;ethyl N-(3-tert-butyl-5-formyl-2-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 91195022 |
| Molecular Formula | C33H41N3O9S |
| Molecular Weight | 655.77 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | N-(3-tert-butyl-5-formyl-2-hydroxyphenyl)-3-(methanesulfonamido)benzamide;ethyl N-(3-tert-butyl-5-formyl-2-hydroxyphenyl)carbamate |
| SMILES | CC(C)(C)c1cc(C=O)cc(NC(=O)c2cccc(NS(C)(=O)=O)c2)c1O.CCOC(=O)Nc1cc(C=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H22N2O5S.C14H19NO4/c1-19(2,3)15-8-12(11-22)9-16(17(15)23)20-18(24)13-6-5-7-14(10-13)21-27(4,25)26;1-5-19-13(18)15-11-7-9(8-16)6-10(12(11)17)14(2,3)4/h5-11,21,23H,1-4H3,(H,20,24);6-8,17H,5H2,1-4H3,(H,15,18) |
| InChIKey | SIBXDWNPOJFHGJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 188.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.77 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|