C36H27N3 — CID 18718564
N-anthracen-1-yl-1-[5-(N-anthracen-1-yl-C-methylcarbonimidoyl)-3H-pyrrol-2-yl]ethanimine (PubChem CID 18718564) has the molecular formula C36H27N3 and a molecular weight of 501.63 g/mol. Its IUPAC name is N-anthracen-1-yl-1-[5-(N-anthracen-1-yl-C-methylcarbonimidoyl)-3H-pyrrol-2-yl]ethanimine.
| Compound Name | N-anthracen-1-yl-1-[5-(N-anthracen-1-yl-C-methylcarbonimidoyl)-3H-pyrrol-2-yl]ethanimine |
|---|---|
| PubChem CID | 18718564 |
| Molecular Formula | C36H27N3 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | N-anthracen-1-yl-1-[5-(N-anthracen-1-yl-C-methylcarbonimidoyl)-3H-pyrrol-2-yl]ethanimine |
| SMILES | C/C(=N\c1cccc2cc3ccccc3cc12)C1=CCC(/C(C)=N/c2cccc3cc4ccccc4cc23)=N1 |
| InChI | InChI=1S/C36H27N3/c1-23(37-35-15-7-13-29-19-25-9-3-5-11-27(25)21-31(29)35)33-17-18-34(39-33)24(2)38-36-16-8-14-30-20-26-10-4-6-12-28(26)22-32(30)36/h3-17,19-22H,18H2,1-2H3/b37-23+,38-24+ |
| InChIKey | DSJGINXAFWOPRA-DNJOOXRZSA-N |
| XLogP | 9.91 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|