C44H37Cl2FeN3P2 — CID 18718653
dichloroiron;N-(4-diphenylphosphanylphenyl)-1-[5-[N-(4-diphenylphosphanylphenyl)-C-methylcarbonimidoyl]-3H-pyrrol-2-yl]ethanimine (PubChem CID 18718653) has the molecular formula C44H37Cl2FeN3P2 and a molecular weight of 796.50 g/mol. Its IUPAC name is dichloroiron;N-(4-diphenylphosphanylphenyl)-1-[5-[N-(4-diphenylphosphanylphenyl)-C-methylcarbonimidoyl]-3H-pyrrol-2-yl]ethanimine.
| Compound Name | dichloroiron;N-(4-diphenylphosphanylphenyl)-1-[5-[N-(4-diphenylphosphanylphenyl)-C-methylcarbonimidoyl]-3H-pyrrol-2-yl]ethanimine |
|---|---|
| PubChem CID | 18718653 |
| Molecular Formula | C44H37Cl2FeN3P2 |
| Molecular Weight | 796.50 g/mol |
| Exact Mass | 795.12 |
| IUPAC Name | dichloroiron;N-(4-diphenylphosphanylphenyl)-1-[5-[N-(4-diphenylphosphanylphenyl)-C-methylcarbonimidoyl]-3H-pyrrol-2-yl]ethanimine |
| SMILES | C/C(=N\c1ccc(P(c2ccccc2)c2ccccc2)cc1)C1=CCC(/C(C)=N/c2ccc(P(c3ccccc3)c3ccccc3)cc2)=N1.Cl[Fe]Cl |
| InChI | InChI=1S/C44H37N3P2.2ClH.Fe/c1-33(45-35-23-27-41(28-24-35)48(37-15-7-3-8-16-37)38-17-9-4-10-18-38)43-31-32-44(47-43)34(2)46-36-25-29-42(30-26-36)49(39-19-11-5-12-20-39)40-21-13-6-14-22-40;;;/h3-31H,32H2,1-2H3;2*1H;/q;;;+2/p-2/b45-33+,46-34+;;; |
| InChIKey | IBZZAINQRYUEJT-YXCSKOCMSA-L |
| XLogP | 10.19 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.50 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|