C18H11F4N3 — CID 18718956
N-(2,6-difluorophenyl)-1-[5-[(2,6-difluorophenyl)iminomethyl]-3H-pyrrol-2-yl]methanimine (PubChem CID 18718956) has the molecular formula C18H11F4N3 and a molecular weight of 345.30 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-1-[5-[(2,6-difluorophenyl)iminomethyl]-3H-pyrrol-2-yl]methanimine.
| Compound Name | N-(2,6-difluorophenyl)-1-[5-[(2,6-difluorophenyl)iminomethyl]-3H-pyrrol-2-yl]methanimine |
|---|---|
| PubChem CID | 18718956 |
| Molecular Formula | C18H11F4N3 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-(2,6-difluorophenyl)-1-[5-[(2,6-difluorophenyl)iminomethyl]-3H-pyrrol-2-yl]methanimine |
| SMILES | Fc1cccc(F)c1/N=C/C1=CCC(/C=N/c2c(F)cccc2F)=N1 |
| InChI | InChI=1S/C18H11F4N3/c19-13-3-1-4-14(20)17(13)23-9-11-7-8-12(25-11)10-24-18-15(21)5-2-6-16(18)22/h1-7,9-10H,8H2/b23-9+,24-10+ |
| InChIKey | NECRERQSVYAGPM-WDBPGAOMSA-N |
| XLogP | 5.08 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|