C41H39N3+2 — CID 18721022
2,7-dimethyl-10-[[4-[[2-[(1-methyl-3H-indol-1-ium-2-yl)methyl]-3H-indol-1-ium-1-yl]methyl]phenyl]methyl]-9H-acridine (PubChem CID 18721022) has the molecular formula C41H39N3+2 and a molecular weight of 573.78 g/mol. Its IUPAC name is 2,7-dimethyl-10-[[4-[[2-[(1-methyl-3H-indol-1-ium-2-yl)methyl]-3H-indol-1-ium-1-yl]methyl]phenyl]methyl]-9H-acridine.
| Compound Name | 2,7-dimethyl-10-[[4-[[2-[(1-methyl-3H-indol-1-ium-2-yl)methyl]-3H-indol-1-ium-1-yl]methyl]phenyl]methyl]-9H-acridine |
|---|---|
| PubChem CID | 18721022 |
| Molecular Formula | C41H39N3+2 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | 2,7-dimethyl-10-[[4-[[2-[(1-methyl-3H-indol-1-ium-2-yl)methyl]-3H-indol-1-ium-1-yl]methyl]phenyl]methyl]-9H-acridine |
| SMILES | Cc1ccc2c(c1)Cc1cc(C)ccc1N2Cc1ccc(C[N+]2=C(CC3=[N+](C)c4ccccc4C3)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C41H39N3/c1-28-12-18-40-34(20-28)22-35-21-29(2)13-19-41(35)44(40)27-31-16-14-30(15-17-31)26-43-37(24-33-9-5-7-11-39(33)43)25-36-23-32-8-4-6-10-38(32)42(36)3/h4-21H,22-27H2,1-3H3/q+2 |
| InChIKey | PHQHTINDCRSTHB-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 9.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|