C45H51N3+2 — CID 90879693
2,7-dimethyl-10-[[4-[[2-[(1-methyl-3H-indol-1-ium-2-yl)methyl]-3H-indol-1-ium-1-yl]methyl]phenyl]methyl]-9H-acridine;ethane (PubChem CID 90879693) has the molecular formula C45H51N3+2 and a molecular weight of 633.92 g/mol. Its IUPAC name is 2,7-dimethyl-10-[[4-[[2-[(1-methyl-3H-indol-1-ium-2-yl)methyl]-3H-indol-1-ium-1-yl]methyl]phenyl]methyl]-9H-acridine;ethane.
| Compound Name | 2,7-dimethyl-10-[[4-[[2-[(1-methyl-3H-indol-1-ium-2-yl)methyl]-3H-indol-1-ium-1-yl]methyl]phenyl]methyl]-9H-acridine;ethane |
|---|---|
| PubChem CID | 90879693 |
| Molecular Formula | C45H51N3+2 |
| Molecular Weight | 633.92 g/mol |
| Exact Mass | 633.41 |
| IUPAC Name | 2,7-dimethyl-10-[[4-[[2-[(1-methyl-3H-indol-1-ium-2-yl)methyl]-3H-indol-1-ium-1-yl]methyl]phenyl]methyl]-9H-acridine;ethane |
| SMILES | CC.CC.Cc1ccc2c(c1)Cc1cc(C)ccc1N2Cc1ccc(C[N+]2=C(CC3=[N+](C)c4ccccc4C3)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C41H39N3.2C2H6/c1-28-12-18-40-34(20-28)22-35-21-29(2)13-19-41(35)44(40)27-31-16-14-30(15-17-31)26-43-37(24-33-9-5-7-11-39(33)43)25-36-23-32-8-4-6-10-38(32)42(36)3;2*1-2/h4-21H,22-27H2,1-3H3;2*1-2H3/q+2;; |
| InChIKey | FXSFQUKNSVZFPM-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 9.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.92 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|