C12H23N3S — CID 18721219
1,5-dimethyl-4-octyl-1,2,4-triazol-4-ium-3-thiolate (PubChem CID 18721219) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is 1,5-dimethyl-4-octyl-1,2,4-triazol-4-ium-3-thiolate.
| Compound Name | 1,5-dimethyl-4-octyl-1,2,4-triazol-4-ium-3-thiolate |
|---|---|
| PubChem CID | 18721219 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1,5-dimethyl-4-octyl-1,2,4-triazol-4-ium-3-thiolate |
| SMILES | CCCCCCCC[n+]1c([S-])nn(C)c1C |
| InChI | InChI=1S/C12H23N3S/c1-4-5-6-7-8-9-10-15-11(2)14(3)13-12(15)16/h4-10H2,1-3H3 |
| InChIKey | APVNBYXRZVJMEG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|